C12H24O2S2 — CID 15680370
S-tert-butyl (2R,3S,4R)-3-hydroxy-2-methyl-4-methylsulfanylhexanethioate (PubChem CID 15680370) has the molecular formula C12H24O2S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is S-tert-butyl (2R,3S,4R)-3-hydroxy-2-methyl-4-methylsulfanylhexanethioate.
| Compound Name | S-tert-butyl (2R,3S,4R)-3-hydroxy-2-methyl-4-methylsulfanylhexanethioate |
|---|---|
| PubChem CID | 15680370 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | S-tert-butyl (2R,3S,4R)-3-hydroxy-2-methyl-4-methylsulfanylhexanethioate |
| SMILES | CC[C@@H](SC)[C@@H](O)[C@@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C12H24O2S2/c1-7-9(15-6)10(13)8(2)11(14)16-12(3,4)5/h8-10,13H,7H2,1-6H3/t8-,9-,10+/m1/s1 |
| InChIKey | YPFJHQNIIYGEKD-BBBLOLIVSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|