C13H26O2S2 — CID 15680373
S-tert-butyl (2R,3S,4R)-3-hydroxy-2,5-dimethyl-4-methylsulfanylhexanethioate (PubChem CID 15680373) has the molecular formula C13H26O2S2 and a molecular weight of 278.48 g/mol. Its IUPAC name is S-tert-butyl (2R,3S,4R)-3-hydroxy-2,5-dimethyl-4-methylsulfanylhexanethioate.
| Compound Name | S-tert-butyl (2R,3S,4R)-3-hydroxy-2,5-dimethyl-4-methylsulfanylhexanethioate |
|---|---|
| PubChem CID | 15680373 |
| Molecular Formula | C13H26O2S2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | S-tert-butyl (2R,3S,4R)-3-hydroxy-2,5-dimethyl-4-methylsulfanylhexanethioate |
| SMILES | CS[C@H](C(C)C)[C@@H](O)[C@@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C13H26O2S2/c1-8(2)11(16-7)10(14)9(3)12(15)17-13(4,5)6/h8-11,14H,1-7H3/t9-,10+,11-/m1/s1 |
| InChIKey | IOTPLBVGVPANPI-OUAUKWLOSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|