C19H25BFN2O7P — CID 156803900
CID 156803900 (PubChem CID 156803900) has the molecular formula C19H25BFN2O7P and a molecular weight of 454.20 g/mol.
| Compound Name | CID 156803900 |
|---|---|
| PubChem CID | 156803900 |
| Molecular Formula | C19H25BFN2O7P |
| Molecular Weight | 454.20 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | — |
| SMILES | CNC(=O)/C(C)=C\N(C=O)C1CCC(COP2(=O)OCc3cc(F)ccc3O2)O1.[B]C |
| InChI | InChI=1S/C18H22FN2O7P.CH3B/c1-12(18(23)20-2)8-21(11-22)17-6-4-15(27-17)10-26-29(24)25-9-13-7-14(19)3-5-16(13)28-29;1-2/h3,5,7-8,11,15,17H,4,6,9-10H2,1-2H3,(H,20,23);1H3/b12-8-; |
| InChIKey | ZOOFVJTWIJVIIW-JCTPKUEWSA-N |
| XLogP | 2.68 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|