C33H52O3SSi — CID 156806445
methyl 5-[3-[tert-butyl(diphenyl)silyl]oxyundecylsulfanyl]pentanoate (PubChem CID 156806445) has the molecular formula C33H52O3SSi and a molecular weight of 556.93 g/mol. Its IUPAC name is methyl 5-[3-[tert-butyl(diphenyl)silyl]oxyundecylsulfanyl]pentanoate.
| Compound Name | methyl 5-[3-[tert-butyl(diphenyl)silyl]oxyundecylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 156806445 |
| Molecular Formula | C33H52O3SSi |
| Molecular Weight | 556.93 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | methyl 5-[3-[tert-butyl(diphenyl)silyl]oxyundecylsulfanyl]pentanoate |
| SMILES | CCCCCCCCC(CCSCCCCC(=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H52O3SSi/c1-6-7-8-9-10-13-20-29(26-28-37-27-19-18-25-32(34)35-5)36-38(33(2,3)4,30-21-14-11-15-22-30)31-23-16-12-17-24-31/h11-12,14-17,21-24,29H,6-10,13,18-20,25-28H2,1-5H3 |
| InChIKey | UDVDBSMXDJGPGR-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.93 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|