C32H50O3SSi — CID 156806479
methyl 3-[3-[tert-butyl(diphenyl)silyl]oxydodecylsulfanyl]propanoate (PubChem CID 156806479) has the molecular formula C32H50O3SSi and a molecular weight of 542.90 g/mol. Its IUPAC name is methyl 3-[3-[tert-butyl(diphenyl)silyl]oxydodecylsulfanyl]propanoate.
| Compound Name | methyl 3-[3-[tert-butyl(diphenyl)silyl]oxydodecylsulfanyl]propanoate |
|---|---|
| PubChem CID | 156806479 |
| Molecular Formula | C32H50O3SSi |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | methyl 3-[3-[tert-butyl(diphenyl)silyl]oxydodecylsulfanyl]propanoate |
| SMILES | CCCCCCCCCC(CCSCCC(=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50O3SSi/c1-6-7-8-9-10-11-14-19-28(24-26-36-27-25-31(33)34-5)35-37(32(2,3)4,29-20-15-12-16-21-29)30-22-17-13-18-23-30/h12-13,15-18,20-23,28H,6-11,14,19,24-27H2,1-5H3 |
| InChIKey | FCUDCYBLPCQSLW-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|