C10H3Cl3F3N — CID 156808230
2,4,8-trichloro-6-(trifluoromethyl)quinoline (PubChem CID 156808230) has the molecular formula C10H3Cl3F3N and a molecular weight of 300.49 g/mol. Its IUPAC name is 2,4,8-trichloro-6-(trifluoromethyl)quinoline.
| Compound Name | 2,4,8-trichloro-6-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 156808230 |
| Molecular Formula | C10H3Cl3F3N |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 2,4,8-trichloro-6-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc(Cl)c2nc(Cl)cc(Cl)c2c1 |
| InChI | InChI=1S/C10H3Cl3F3N/c11-6-3-8(13)17-9-5(6)1-4(2-7(9)12)10(14,15)16/h1-3H |
| InChIKey | LKQSWOIXBJCFHN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|