C25H36N8O2 — CID 156813378
7-N-butyl-1-[[3-methoxy-5-[1-(oxolan-3-yl)piperidin-4-yl]-2-pyridinyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 156813378) has the molecular formula C25H36N8O2 and a molecular weight of 480.62 g/mol. Its IUPAC name is 7-N-butyl-1-[[3-methoxy-5-[1-(oxolan-3-yl)piperidin-4-yl]-2-pyridinyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-butyl-1-[[3-methoxy-5-[1-(oxolan-3-yl)piperidin-4-yl]-2-pyridinyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 156813378 |
| Molecular Formula | C25H36N8O2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 7-N-butyl-1-[[3-methoxy-5-[1-(oxolan-3-yl)piperidin-4-yl]-2-pyridinyl]methyl]pyrazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCCCNc1nc(N)nc2cnn(Cc3ncc(C4CCN(C5CCOC5)CC4)cc3OC)c12 |
| InChI | InChI=1S/C25H36N8O2/c1-3-4-8-27-24-23-20(30-25(26)31-24)14-29-33(23)15-21-22(34-2)12-18(13-28-21)17-5-9-32(10-6-17)19-7-11-35-16-19/h12-14,17,19H,3-11,15-16H2,1-2H3,(H3,26,27,30,31) |
| InChIKey | OQRGWUMCNYKLNY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|