C23H22F3N3O3 — CID 156816303
cyclobutanecarboxamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;pyrrolidine-2,5-dione (PubChem CID 156816303) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is cyclobutanecarboxamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;pyrrolidine-2,5-dione.
| Compound Name | cyclobutanecarboxamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 156816303 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | cyclobutanecarboxamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole;pyrrolidine-2,5-dione |
| SMILES | Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.NC(=O)C1CCC1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C14H8F3N.C5H9NO.C4H5NO2/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;6-5(7)4-2-1-3-4;6-3-1-2-4(7)5-3/h1-7,18H;4H,1-3H2,(H2,6,7);1-2H2,(H,5,6,7) |
| InChIKey | BMONKCSLPGJGMT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|