About N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole
N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole (PubChem CID 162389792) has the molecular formula C21H23F3N2OS
and a molecular weight of 408.49 g/mol. Its IUPAC name is N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
Molecular Properties
| Compound Name | N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| PubChem CID | 162389792 |
| Molecular Formula | C21H23F3N2OS |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| SMILES | CCS(=O)NCC1CCC1.Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1 |
| InChI | InChI=1S/C14H8F3N.C7H15NOS/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;1-2-10(9)8-6-7-4-3-5-7/h1-7,18H;7-8H,2-6H2,1H3 |
| InChIKey | NWBOLJWJLWQABI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The IUPAC name of N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole (CID 162389792) is N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
What is the SMILES notation for N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The canonical SMILES for N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole is CCS(=O)NCC1CCC1.Fc1ccc(-c2cc3cc(F)cc(F)c3[nH]2)cc1.
What is the InChIKey of N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The InChIKey is NWBOLJWJLWQABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3N.C7H15NOS/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13;1-2-10(9)8-6-7-4-3-5-7/h1-7,18H;7-8H,2-6H2,1H3.
What are the key properties of N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole has a molecular weight of 408.49 g/mol, XLogP of 5.31, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclobutylmethyl)ethanesulfinamide;5,7-difluoro-2-(4-fluorophenyl)-1H-indole is sourced from PubChem (CID 162389792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).