C9H18N2 — CID 156817521
ethane;(3E)-N-(methylideneamino)hexa-3,5-dien-3-amine (PubChem CID 156817521) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;(3E)-N-(methylideneamino)hexa-3,5-dien-3-amine.
| Compound Name | ethane;(3E)-N-(methylideneamino)hexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 156817521 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;(3E)-N-(methylideneamino)hexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\CC)NN=C.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-4-6-7(5-2)9-8-3;1-2/h4,6,9H,1,3,5H2,2H3;1-2H3/b7-6+; |
| InChIKey | LWJQSBAIZQBZQH-UHDJGPCESA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|