C33H54NO10P — CID 156817731
5-[[2-[[(4R)-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]acetyl]oxymethoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid (PubChem CID 156817731) has the molecular formula C33H54NO10P and a molecular weight of 655.77 g/mol. Its IUPAC name is 5-[[2-[[(4R)-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]acetyl]oxymethoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid.
| Compound Name | 5-[[2-[[(4R)-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]acetyl]oxymethoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid |
|---|---|
| PubChem CID | 156817731 |
| Molecular Formula | C33H54NO10P |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | 5-[[2-[[(4R)-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]acetyl]oxymethoxy]-5-oxo-2-(phosphonomethyl)pentanoic acid |
| SMILES | C[C@H](CCC(=O)NCC(=O)OCOC(=O)CCC(CP(=O)(O)O)C(=O)O)C1CCC2C3CCC4CCCCC4(C)C3CCC21C |
| InChI | InChI=1S/C33H54NO10P/c1-21(25-11-12-26-24-10-9-23-6-4-5-16-32(23,2)27(24)15-17-33(25,26)3)7-13-28(35)34-18-30(37)44-20-43-29(36)14-8-22(31(38)39)19-45(40,41)42/h21-27H,4-20H2,1-3H3,(H,34,35)(H,38,39)(H2,40,41,42)/t21-,22?,23?,24?,25?,26?,27?,32?,33?/m1/s1 |
| InChIKey | LRYRYTTZUJFONF-RFYMVCPQSA-N |
| XLogP | 5.27 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|