C7H10N2O3 — CID 156818359
4-(2-nitrosoethylamino)pent-4-ene-2,3-dione (PubChem CID 156818359) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-(2-nitrosoethylamino)pent-4-ene-2,3-dione.
| Compound Name | 4-(2-nitrosoethylamino)pent-4-ene-2,3-dione |
|---|---|
| PubChem CID | 156818359 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4-(2-nitrosoethylamino)pent-4-ene-2,3-dione |
| SMILES | C=C(NCCN=O)C(=O)C(C)=O |
| InChI | InChI=1S/C7H10N2O3/c1-5(7(11)6(2)10)8-3-4-9-12/h8H,1,3-4H2,2H3 |
| InChIKey | IJFNZESNCYKXLP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|