C10H14O5 — CID 88513222
pentane-2,4-dione;pentane-2,3,4-trione (PubChem CID 88513222) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is pentane-2,4-dione;pentane-2,3,4-trione.
| Compound Name | pentane-2,4-dione;pentane-2,3,4-trione |
|---|---|
| PubChem CID | 88513222 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | pentane-2,4-dione;pentane-2,3,4-trione |
| SMILES | CC(=O)C(=O)C(C)=O.CC(=O)CC(C)=O |
| InChI | InChI=1S/C5H6O3.C5H8O2/c1-3(6)5(8)4(2)7;1-4(6)3-5(2)7/h1-2H3;3H2,1-2H3 |
| InChIKey | LJVYVBQRBMPDJL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|