C47H92N2O4 — CID 156818368
[(Z)-non-2-enyl] 8-[3-[(2-methoxyacetyl)amino]propyl-(8-octylhexadecyl)amino]octanoate (PubChem CID 156818368) has the molecular formula C47H92N2O4 and a molecular weight of 749.26 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[3-[(2-methoxyacetyl)amino]propyl-(8-octylhexadecyl)amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[3-[(2-methoxyacetyl)amino]propyl-(8-octylhexadecyl)amino]octanoate |
|---|---|
| PubChem CID | 156818368 |
| Molecular Formula | C47H92N2O4 |
| Molecular Weight | 749.26 g/mol |
| Exact Mass | 748.71 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[3-[(2-methoxyacetyl)amino]propyl-(8-octylhexadecyl)amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(CCCCCCCC)CCCCCCCC)CCCNC(=O)COC |
| InChI | InChI=1S/C47H92N2O4/c1-5-8-11-14-17-26-33-43-53-47(51)38-30-23-19-25-32-41-49(42-34-39-48-46(50)44-52-4)40-31-24-18-22-29-37-45(35-27-20-15-12-9-6-2)36-28-21-16-13-10-7-3/h26,33,45H,5-25,27-32,34-44H2,1-4H3,(H,48,50)/b33-26- |
| InChIKey | PZEDZPRVYZDUCT-MKFPQRGTSA-N |
| XLogP | 13.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.26 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|