C42H78N2O5 — CID 76686521
bis(non-2-enyl) 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate (PubChem CID 76686521) has the molecular formula C42H78N2O5 and a molecular weight of 691.09 g/mol. Its IUPAC name is bis(non-2-enyl) 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate.
| Compound Name | bis(non-2-enyl) 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate |
|---|---|
| PubChem CID | 76686521 |
| Molecular Formula | C42H78N2O5 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.59 |
| IUPAC Name | bis(non-2-enyl) 9-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]heptadecanedioate |
| SMILES | CCCCCCC=CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCC=CCCCCCC)CC(=O)NCCCN(C)C |
| InChI | InChI=1S/C42H78N2O5/c1-5-7-9-11-13-21-27-36-48-41(46)32-25-19-15-17-23-30-39(38-40(45)43-34-29-35-44(3)4)31-24-18-16-20-26-33-42(47)49-37-28-22-14-12-10-8-6-2/h21-22,27-28,39H,5-20,23-26,29-38H2,1-4H3,(H,43,45) |
| InChIKey | LKZPIZMQFGKMAS-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|