C56H47N — CID 156821324
N-(3,5-diphenylcyclohexa-1,3-dien-1-yl)-2'-ethenyl-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-3-amine (PubChem CID 156821324) has the molecular formula C56H47N and a molecular weight of 734.00 g/mol. Its IUPAC name is N-(3,5-diphenylcyclohexa-1,3-dien-1-yl)-2'-ethenyl-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-3-amine.
| Compound Name | N-(3,5-diphenylcyclohexa-1,3-dien-1-yl)-2'-ethenyl-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-3-amine |
|---|---|
| PubChem CID | 156821324 |
| Molecular Formula | C56H47N |
| Molecular Weight | 734.00 g/mol |
| Exact Mass | 733.37 |
| IUPAC Name | N-(3,5-diphenylcyclohexa-1,3-dien-1-yl)-2'-ethenyl-N-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,1'-indene]-3-amine |
| SMILES | C=CC1=C(/C=C\C)c2ccccc2C12c1ccccc1-c1cc(N(C3=CC(c4ccccc4)=CC(c4ccccc4)C3)c3ccccc3C(/C=C\C)=C/C)ccc12 |
| InChI | InChI=1S/C56H47N/c1-5-21-39(7-3)46-27-17-20-32-55(46)57(45-36-42(40-23-11-9-12-24-40)35-43(37-45)41-25-13-10-14-26-41)44-33-34-54-50(38-44)49-29-16-19-31-53(49)56(54)51(8-4)47(22-6-2)48-28-15-18-30-52(48)56/h5-36,38,43H,4,37H2,1-3H3/b21-5-,22-6-,39-7+ |
| InChIKey | NIYNMMJKZHTVEE-FGTCZNFZSA-N |
| XLogP | 14.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.00 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|