C49H51N — CID 163589369
9,9,10,10-tetramethyl-N-(5-methyl-3-phenylcyclohexa-1,3-dien-1-yl)-N-(9,9,10,10-tetramethylanthracen-2-yl)anthracen-2-amine (PubChem CID 163589369) has the molecular formula C49H51N and a molecular weight of 653.95 g/mol. Its IUPAC name is 9,9,10,10-tetramethyl-N-(5-methyl-3-phenylcyclohexa-1,3-dien-1-yl)-N-(9,9,10,10-tetramethylanthracen-2-yl)anthracen-2-amine.
| Compound Name | 9,9,10,10-tetramethyl-N-(5-methyl-3-phenylcyclohexa-1,3-dien-1-yl)-N-(9,9,10,10-tetramethylanthracen-2-yl)anthracen-2-amine |
|---|---|
| PubChem CID | 163589369 |
| Molecular Formula | C49H51N |
| Molecular Weight | 653.95 g/mol |
| Exact Mass | 653.40 |
| IUPAC Name | 9,9,10,10-tetramethyl-N-(5-methyl-3-phenylcyclohexa-1,3-dien-1-yl)-N-(9,9,10,10-tetramethylanthracen-2-yl)anthracen-2-amine |
| SMILES | CC1C=C(c2ccccc2)C=C(N(c2ccc3c(c2)C(C)(C)c2ccccc2C3(C)C)c2ccc3c(c2)C(C)(C)c2ccccc2C3(C)C)C1 |
| InChI | InChI=1S/C49H51N/c1-32-27-34(33-17-11-10-12-18-33)29-37(28-32)50(35-23-25-42-44(30-35)48(6,7)40-21-15-13-19-38(40)46(42,2)3)36-24-26-43-45(31-36)49(8,9)41-22-16-14-20-39(41)47(43,4)5/h10-27,29-32H,28H2,1-9H3 |
| InChIKey | GOFCQJWIEVZAAZ-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.95 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |