About 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline
2-(3,3-dimethylpent-1-ynyl)-5-methylaniline (PubChem CID 156821738) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline.
Molecular Properties
| Compound Name | 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline |
| PubChem CID | 156821738 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline |
| SMILES | CCC(C)(C)C#Cc1ccc(C)cc1N |
| InChI | InChI=1S/C14H19N/c1-5-14(3,4)9-8-12-7-6-11(2)10-13(12)15/h6-7,10H,5,15H2,1-4H3 |
| InChIKey | IXJMDUUUIFSPQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline?
The IUPAC name of 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline (CID 156821738) is 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline.
What is the SMILES notation for 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline?
The canonical SMILES for 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline is CCC(C)(C)C#Cc1ccc(C)cc1N.
What is the InChIKey of 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline?
The InChIKey is IXJMDUUUIFSPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-5-14(3,4)9-8-12-7-6-11(2)10-13(12)15/h6-7,10H,5,15H2,1-4H3.
What are the key properties of 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline?
2-(3,3-dimethylpent-1-ynyl)-5-methylaniline has a molecular weight of 201.31 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylpent-1-ynyl)-5-methylaniline is sourced from PubChem (CID 156821738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).