C13H16N2O3S — CID 156824387
ethyl N-[N-benzyl-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate (PubChem CID 156824387) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl N-[N-benzyl-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-benzyl-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 156824387 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl N-[N-benzyl-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N/Cc1ccccc1)SCC=O |
| InChI | InChI=1S/C13H16N2O3S/c1-2-18-13(17)15-12(19-9-8-16)14-10-11-6-4-3-5-7-11/h3-8H,2,9-10H2,1H3,(H,14,15,17) |
| InChIKey | OXQJLMDPSLSBFN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|