C11H12BrN3O3S — CID 156824318
ethyl N-[N-(2-bromo-4-pyridinyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate (PubChem CID 156824318) has the molecular formula C11H12BrN3O3S and a molecular weight of 346.21 g/mol. Its IUPAC name is ethyl N-[N-(2-bromo-4-pyridinyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-(2-bromo-4-pyridinyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 156824318 |
| Molecular Formula | C11H12BrN3O3S |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | ethyl N-[N-(2-bromo-4-pyridinyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N/c1ccnc(Br)c1)SCC=O |
| InChI | InChI=1S/C11H12BrN3O3S/c1-2-18-11(17)15-10(19-6-5-16)14-8-3-4-13-9(12)7-8/h3-5,7H,2,6H2,1H3,(H,13,14,15,17) |
| InChIKey | GIVBJZMTZRRSAJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|