C12H13BrN2O3S — CID 156824409
ethyl N-[N-(2-bromophenyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate (PubChem CID 156824409) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is ethyl N-[N-(2-bromophenyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-(2-bromophenyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 156824409 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | ethyl N-[N-(2-bromophenyl)-C-(2-oxoethylsulfanyl)carbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N/c1ccccc1Br)SCC=O |
| InChI | InChI=1S/C12H13BrN2O3S/c1-2-18-12(17)15-11(19-8-7-16)14-10-6-4-3-5-9(10)13/h3-7H,2,8H2,1H3,(H,14,15,17) |
| InChIKey | FQOURMPTGKGFKU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|