C16H14FN3O3 — CID 156824842
5-(5-fluoro-3-pyridinyl)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-one (PubChem CID 156824842) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 5-(5-fluoro-3-pyridinyl)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-one.
| Compound Name | 5-(5-fluoro-3-pyridinyl)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 156824842 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-(5-fluoro-3-pyridinyl)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(c2cncc(F)c2)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14FN3O3/c17-13-7-12(8-18-9-13)15-5-6-16(21)19(15)10-11-1-3-14(4-2-11)20(22)23/h1-4,7-9,15H,5-6,10H2 |
| InChIKey | HHSIZSSCLWZVAW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|