C20H21FN2O2 — CID 132517830
(4aS,9aS)-10-[(4-fluorophenyl)methyl]-7-nitro-2,3,4,4a,9,9a-hexahydro-1H-acridine (PubChem CID 132517830) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is (4aS,9aS)-10-[(4-fluorophenyl)methyl]-7-nitro-2,3,4,4a,9,9a-hexahydro-1H-acridine.
| Compound Name | (4aS,9aS)-10-[(4-fluorophenyl)methyl]-7-nitro-2,3,4,4a,9,9a-hexahydro-1H-acridine |
|---|---|
| PubChem CID | 132517830 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (4aS,9aS)-10-[(4-fluorophenyl)methyl]-7-nitro-2,3,4,4a,9,9a-hexahydro-1H-acridine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C[C@@H]1CCCC[C@@H]1N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c21-17-7-5-14(6-8-17)13-22-19-4-2-1-3-15(19)11-16-12-18(23(24)25)9-10-20(16)22/h5-10,12,15,19H,1-4,11,13H2/t15-,19-/m0/s1 |
| InChIKey | AYHPKISNXFYJTP-KXBFYZLASA-N |
| XLogP | 4.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|