C34H42N4O5 — CID 156825598
(3S)-N-benzyl-3-[[(2S)-3-cyclohexyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-5-(5-oxopyrrolidin-3-yl)pentanamide (PubChem CID 156825598) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[[(2S)-3-cyclohexyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-5-(5-oxopyrrolidin-3-yl)pentanamide.
| Compound Name | (3S)-N-benzyl-3-[[(2S)-3-cyclohexyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-5-(5-oxopyrrolidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 156825598 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | (3S)-N-benzyl-3-[[(2S)-3-cyclohexyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-5-(5-oxopyrrolidin-3-yl)pentanamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](CC1CCCCC1)C(=O)N[C@@H](CCC1CNC(=O)C1)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H42N4O5/c39-30(19-17-24-10-4-1-5-11-24)37-29(20-25-12-6-2-7-13-25)33(42)38-28(18-16-27-21-31(40)35-23-27)32(41)34(43)36-22-26-14-8-3-9-15-26/h1,3-5,8-11,14-15,17,19,25,27-29H,2,6-7,12-13,16,18,20-23H2,(H,35,40)(H,36,43)(H,37,39)(H,38,42)/b19-17+/t27?,28-,29-/m0/s1 |
| InChIKey | JPIMJGITGUAMBI-UTWXYXOQSA-N |
| XLogP | 3.44 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|