C54H50N2 — CID 156826962
N-[4-(6,9-dihydro-5H-carbazol-1-yl)phenyl]-N-[(1E,3Z)-1-(9,9-dimethyl-3,4,7,8-tetrahydrofluoren-3-yl)hexa-1,3,5-trienyl]-9,9-dimethylfluoren-1-amine (PubChem CID 156826962) has the molecular formula C54H50N2 and a molecular weight of 727.01 g/mol. Its IUPAC name is N-[4-(6,9-dihydro-5H-carbazol-1-yl)phenyl]-N-[(1E,3Z)-1-(9,9-dimethyl-3,4,7,8-tetrahydrofluoren-3-yl)hexa-1,3,5-trienyl]-9,9-dimethylfluoren-1-amine.
| Compound Name | N-[4-(6,9-dihydro-5H-carbazol-1-yl)phenyl]-N-[(1E,3Z)-1-(9,9-dimethyl-3,4,7,8-tetrahydrofluoren-3-yl)hexa-1,3,5-trienyl]-9,9-dimethylfluoren-1-amine |
|---|---|
| PubChem CID | 156826962 |
| Molecular Formula | C54H50N2 |
| Molecular Weight | 727.01 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | N-[4-(6,9-dihydro-5H-carbazol-1-yl)phenyl]-N-[(1E,3Z)-1-(9,9-dimethyl-3,4,7,8-tetrahydrofluoren-3-yl)hexa-1,3,5-trienyl]-9,9-dimethylfluoren-1-amine |
| SMILES | C=C/C=C\C=C(/C1C=CC2=C(C1)C1=C(CCC=C1)C2(C)C)N(c1ccc(-c2cccc3c4c([nH]c23)C=CCC4)cc1)c1cccc2c1C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C54H50N2/c1-6-7-8-26-49(36-30-33-47-44(34-36)40-18-10-12-23-45(40)53(47,2)3)56(50-27-16-21-42-39-17-9-13-24-46(39)54(4,5)51(42)50)37-31-28-35(29-32-37)38-20-15-22-43-41-19-11-14-25-48(41)55-52(38)43/h6-10,13-18,20-22,24-33,36,55H,1,11-12,19,23,34H2,2-5H3/b8-7-,49-26+ |
| InChIKey | SQQVOUKRTZVIBR-LTNFSBBVSA-N |
| XLogP | 14.42 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.01 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|