C22H20N4O3S — CID 156827961
N-(1H-indol-6-ylsulfamoyl)-4-phenyl-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 156827961) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(1H-indol-6-ylsulfamoyl)-4-phenyl-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | N-(1H-indol-6-ylsulfamoyl)-4-phenyl-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 156827961 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(1H-indol-6-ylsulfamoyl)-4-phenyl-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCCN2c1ccccc1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C22H20N4O3S/c27-30(28,24-17-7-6-16-10-11-23-20(16)14-17)25-18-8-9-21-22(15-18)29-13-12-26(21)19-4-2-1-3-5-19/h1-11,14-15,23-25H,12-13H2 |
| InChIKey | MIMODJNRJIBGBC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|