About ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate
ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate (PubChem CID 156835864) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate.
Molecular Properties
| Compound Name | ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate |
| PubChem CID | 156835864 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate |
| SMILES | CC.CC(N)C(=O)OCC(C)(C)OCc1ccccc1 |
| InChI | InChI=1S/C14H21NO3.C2H6/c1-11(15)13(16)17-10-14(2,3)18-9-12-7-5-4-6-8-12;1-2/h4-8,11H,9-10,15H2,1-3H3;1-2H3 |
| InChIKey | GOTJYSHTMWOYTE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate?
The IUPAC name of ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate (CID 156835864) is ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate.
What is the SMILES notation for ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate?
The canonical SMILES for ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate is CC.CC(N)C(=O)OCC(C)(C)OCc1ccccc1.
What is the InChIKey of ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate?
The InChIKey is GOTJYSHTMWOYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3.C2H6/c1-11(15)13(16)17-10-14(2,3)18-9-12-7-5-4-6-8-12;1-2/h4-8,11H,9-10,15H2,1-3H3;1-2H3.
What are the key properties of ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate?
ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate has a molecular weight of 281.40 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methyl-2-phenylmethoxypropyl) 2-aminopropanoate is sourced from PubChem (CID 156835864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).