C25H25N2OSi — CID 156839173
CID 156839173 (PubChem CID 156839173) has the molecular formula C25H25N2OSi and a molecular weight of 397.57 g/mol.
| Compound Name | CID 156839173 |
|---|---|
| PubChem CID | 156839173 |
| Molecular Formula | C25H25N2OSi |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | — |
| SMILES | CC12C(CNC[C@H]1c1ccccc1)[Si]2C(=O)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H25N2OSi/c1-25-22(19-11-6-3-7-12-19)16-26-17-23(25)29(25)24(28)27-21-14-8-13-20(15-21)18-9-4-2-5-10-18/h2-15,22-23,26H,16-17H2,1H3,(H,27,28)/t22-,23?,25?/m0/s1 |
| InChIKey | IMKAUWCLHSGDIR-ICXLUZGWSA-N |
| XLogP | 5.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|