C14H24N2O — CID 156841487
N-[(3Z)-5-(methylamino)hexa-1,3,5-trien-2-yl]heptanamide (PubChem CID 156841487) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[(3Z)-5-(methylamino)hexa-1,3,5-trien-2-yl]heptanamide.
| Compound Name | N-[(3Z)-5-(methylamino)hexa-1,3,5-trien-2-yl]heptanamide |
|---|---|
| PubChem CID | 156841487 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-[(3Z)-5-(methylamino)hexa-1,3,5-trien-2-yl]heptanamide |
| SMILES | C=C(/C=C\C(=C)NC(=O)CCCCCC)NC |
| InChI | InChI=1S/C14H24N2O/c1-5-6-7-8-9-14(17)16-13(3)11-10-12(2)15-4/h10-11,15H,2-3,5-9H2,1,4H3,(H,16,17)/b11-10- |
| InChIKey | QUXRTZBUXUFQSS-KHPPLWFESA-N |
| XLogP | 2.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|