C18H26ClNO5 — CID 156841569
[1-hydroxy-3-(4-methylpentanoylamino)propan-2-yl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 156841569) has the molecular formula C18H26ClNO5 and a molecular weight of 371.86 g/mol. Its IUPAC name is [1-hydroxy-3-(4-methylpentanoylamino)propan-2-yl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [1-hydroxy-3-(4-methylpentanoylamino)propan-2-yl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 156841569 |
| Molecular Formula | C18H26ClNO5 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [1-hydroxy-3-(4-methylpentanoylamino)propan-2-yl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OC(CO)CNC(=O)CCC(C)C |
| InChI | InChI=1S/C18H26ClNO5/c1-12(2)4-7-17(22)20-9-15(10-21)25-18(23)11-24-16-6-5-14(19)8-13(16)3/h5-6,8,12,15,21H,4,7,9-11H2,1-3H3,(H,20,22) |
| InChIKey | OXHVAXNTTBGVSR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |