C23H28F2N2O2 — CID 156843971
methyl N-[(2E,4E)-4-cyclopropyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]-2-[(3,5-difluorobenzoyl)amino]ethanimidate (PubChem CID 156843971) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl N-[(2E,4E)-4-cyclopropyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]-2-[(3,5-difluorobenzoyl)amino]ethanimidate.
| Compound Name | methyl N-[(2E,4E)-4-cyclopropyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]-2-[(3,5-difluorobenzoyl)amino]ethanimidate |
|---|---|
| PubChem CID | 156843971 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | methyl N-[(2E,4E)-4-cyclopropyl-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]-2-[(3,5-difluorobenzoyl)amino]ethanimidate |
| SMILES | C/C=C\C(=C/C(=C/CC)C1CC1)C/N=C(/CNC(=O)c1cc(F)cc(F)c1)OC |
| InChI | InChI=1S/C23H28F2N2O2/c1-4-6-16(10-18(7-5-2)17-8-9-17)14-26-22(29-3)15-27-23(28)19-11-20(24)13-21(25)12-19/h4,6-7,10-13,17H,5,8-9,14-15H2,1-3H3,(H,27,28)/b6-4-,16-10+,18-7-,26-22- |
| InChIKey | BUYYPEDUJYHVHQ-ZRMQHFSMSA-N |
| XLogP | 4.99 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|