C24H35F4N5O2 — CID 155718555
ethane;methyl N-[(5E,6Z)-5-[(Z)-1-fluorobut-1-enyl]imino-3-methylocta-3,6-dien-4-yl]-2-[[1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl]amino]ethanimidate (PubChem CID 155718555) has the molecular formula C24H35F4N5O2 and a molecular weight of 501.57 g/mol. Its IUPAC name is ethane;methyl N-[(5E,6Z)-5-[(Z)-1-fluorobut-1-enyl]imino-3-methylocta-3,6-dien-4-yl]-2-[[1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl]amino]ethanimidate.
| Compound Name | ethane;methyl N-[(5E,6Z)-5-[(Z)-1-fluorobut-1-enyl]imino-3-methylocta-3,6-dien-4-yl]-2-[[1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl]amino]ethanimidate |
|---|---|
| PubChem CID | 155718555 |
| Molecular Formula | C24H35F4N5O2 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | ethane;methyl N-[(5E,6Z)-5-[(Z)-1-fluorobut-1-enyl]imino-3-methylocta-3,6-dien-4-yl]-2-[[1-methyl-3-(trifluoromethyl)pyrazole-5-carbonyl]amino]ethanimidate |
| SMILES | C/C=C\C(=N/C(F)=C/CC)C(/N=C(/CNC(=O)c1cc(C(F)(F)F)nn1C)OC)=C(C)CC.CC |
| InChI | InChI=1S/C22H29F4N5O2.C2H6/c1-7-10-15(28-18(23)11-8-2)20(14(4)9-3)29-19(33-6)13-27-21(32)16-12-17(22(24,25)26)30-31(16)5;1-2/h7,10-12H,8-9,13H2,1-6H3,(H,27,32);1-2H3/b10-7-,18-11+,20-14?,28-15+,29-19-; |
| InChIKey | QUUBPGKLIGKVCU-WXAJHFCKSA-N |
| XLogP | 6.16 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|