C27H36F3N3O2 — CID 156843937
methyl 2-[[2-(N-methylanilino)acetyl]amino]-N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]ethanimidate (PubChem CID 156843937) has the molecular formula C27H36F3N3O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is methyl 2-[[2-(N-methylanilino)acetyl]amino]-N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]ethanimidate.
| Compound Name | methyl 2-[[2-(N-methylanilino)acetyl]amino]-N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]ethanimidate |
|---|---|
| PubChem CID | 156843937 |
| Molecular Formula | C27H36F3N3O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | methyl 2-[[2-(N-methylanilino)acetyl]amino]-N-[(5E,7Z)-3-methyl-5-[(Z)-prop-1-enyl]-7-(trifluoromethyl)deca-3,5,7-trien-4-yl]ethanimidate |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)C(/N=C(/CNC(=O)CN(C)c1ccccc1)OC)=C(C)CC |
| InChI | InChI=1S/C27H36F3N3O2/c1-7-13-21(17-22(14-8-2)27(28,29)30)26(20(4)9-3)32-25(35-6)18-31-24(34)19-33(5)23-15-11-10-12-16-23/h7,10-17H,8-9,18-19H2,1-6H3,(H,31,34)/b13-7-,21-17+,22-14-,26-20?,32-25- |
| InChIKey | ROSLYSQLDPZGDW-BDENWQAPSA-N |
| XLogP | 6.37 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|