C25H31FN2O2 — CID 142280073
4-(3-fluoro-5-hydroxyphenyl)-N-[[4-[(2Z,4Z)-hepta-2,4-dien-4-yl]cyclohexyl]methyl]-1H-pyrrole-3-carboxamide (PubChem CID 142280073) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is 4-(3-fluoro-5-hydroxyphenyl)-N-[[4-[(2Z,4Z)-hepta-2,4-dien-4-yl]cyclohexyl]methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(3-fluoro-5-hydroxyphenyl)-N-[[4-[(2Z,4Z)-hepta-2,4-dien-4-yl]cyclohexyl]methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142280073 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-(3-fluoro-5-hydroxyphenyl)-N-[[4-[(2Z,4Z)-hepta-2,4-dien-4-yl]cyclohexyl]methyl]-1H-pyrrole-3-carboxamide |
| SMILES | C/C=C\C(=C/CC)C1CCC(CNC(=O)c2c[nH]cc2-c2cc(O)cc(F)c2)CC1 |
| InChI | InChI=1S/C25H31FN2O2/c1-3-5-18(6-4-2)19-9-7-17(8-10-19)14-28-25(30)24-16-27-15-23(24)20-11-21(26)13-22(29)12-20/h3,5-6,11-13,15-17,19,27,29H,4,7-10,14H2,1-2H3,(H,28,30)/b5-3-,18-6+ |
| InChIKey | LAWVSQHETPHCHW-HXHGMITMSA-N |
| XLogP | 5.98 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|