About magnesium;1-ethyl-4-heptylbenzene;bromide
magnesium;1-ethyl-4-heptylbenzene;bromide (PubChem CID 156847228) has the molecular formula C15H23BrMg
and a molecular weight of 307.56 g/mol. Its IUPAC name is magnesium;1-ethyl-4-heptylbenzene;bromide.
Molecular Properties
| Compound Name | magnesium;1-ethyl-4-heptylbenzene;bromide |
| PubChem CID | 156847228 |
| Molecular Formula | C15H23BrMg |
| Molecular Weight | 307.56 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | magnesium;1-ethyl-4-heptylbenzene;bromide |
| SMILES | [Br-].[CH2-]Cc1ccc(CCCCCCC)cc1.[Mg+2] |
| InChI | InChI=1S/C15H23.BrH.Mg/c1-3-5-6-7-8-9-15-12-10-14(4-2)11-13-15;;/h10-13H,2-9H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | UGZYRVXTUPQQQH-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-ethyl-4-heptylbenzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-ethyl-4-heptylbenzene;bromide?
The IUPAC name of magnesium;1-ethyl-4-heptylbenzene;bromide (CID 156847228) is magnesium;1-ethyl-4-heptylbenzene;bromide.
What is the SMILES notation for magnesium;1-ethyl-4-heptylbenzene;bromide?
The canonical SMILES for magnesium;1-ethyl-4-heptylbenzene;bromide is [Br-].[CH2-]Cc1ccc(CCCCCCC)cc1.[Mg+2].
What is the InChIKey of magnesium;1-ethyl-4-heptylbenzene;bromide?
The InChIKey is UGZYRVXTUPQQQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H23.BrH.Mg/c1-3-5-6-7-8-9-15-12-10-14(4-2)11-13-15;;/h10-13H,2-9H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1-ethyl-4-heptylbenzene;bromide?
magnesium;1-ethyl-4-heptylbenzene;bromide has a molecular weight of 307.56 g/mol, XLogP of 1.20, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-ethyl-4-heptylbenzene;bromide is sourced from PubChem (CID 156847228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).