C21H23F2N3O2 — CID 156847716
3-cyclopropyl-N-(3,4-difluorophenyl)-2,6,6-trimethyl-4-oxo-7,8-dihydro-5H-pyrrolo[3,4-c]azepine-1-carboxamide (PubChem CID 156847716) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-cyclopropyl-N-(3,4-difluorophenyl)-2,6,6-trimethyl-4-oxo-7,8-dihydro-5H-pyrrolo[3,4-c]azepine-1-carboxamide.
| Compound Name | 3-cyclopropyl-N-(3,4-difluorophenyl)-2,6,6-trimethyl-4-oxo-7,8-dihydro-5H-pyrrolo[3,4-c]azepine-1-carboxamide |
|---|---|
| PubChem CID | 156847716 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-cyclopropyl-N-(3,4-difluorophenyl)-2,6,6-trimethyl-4-oxo-7,8-dihydro-5H-pyrrolo[3,4-c]azepine-1-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(F)c(F)c2)c2c(c1C1CC1)C(=O)NC(C)(C)CC2 |
| InChI | InChI=1S/C21H23F2N3O2/c1-21(2)9-8-13-16(19(27)25-21)17(11-4-5-11)26(3)18(13)20(28)24-12-6-7-14(22)15(23)10-12/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | WEYQHEUQJQPSHE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |