C27H51O4PSi3 — CID 156853003
tris[hepta-1,6-dien-4-yl(dimethyl)silyl] phosphate (PubChem CID 156853003) has the molecular formula C27H51O4PSi3 and a molecular weight of 554.93 g/mol. Its IUPAC name is tris[hepta-1,6-dien-4-yl(dimethyl)silyl] phosphate.
| Compound Name | tris[hepta-1,6-dien-4-yl(dimethyl)silyl] phosphate |
|---|---|
| PubChem CID | 156853003 |
| Molecular Formula | C27H51O4PSi3 |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | tris[hepta-1,6-dien-4-yl(dimethyl)silyl] phosphate |
| SMILES | C=CCC(CC=C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(CC=C)CC=C)O[Si](C)(C)C(CC=C)CC=C |
| InChI | InChI=1S/C27H51O4PSi3/c1-13-19-25(20-14-2)33(7,8)29-32(28,30-34(9,10)26(21-15-3)22-16-4)31-35(11,12)27(23-17-5)24-18-6/h13-18,25-27H,1-6,19-24H2,7-12H3 |
| InChIKey | PRQRPXGXVMKRFG-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|