C25H23N3O4S — CID 156859982
N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]quinoline-6-carboxamide (PubChem CID 156859982) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]quinoline-6-carboxamide.
| Compound Name | N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 156859982 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]quinoline-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3ncccc3c2)cc1S(=O)(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C25H23N3O4S/c1-16-6-4-7-17(2)24(16)28-33(30,31)23-15-20(10-12-22(23)32-3)27-25(29)19-9-11-21-18(14-19)8-5-13-26-21/h4-15,28H,1-3H3,(H,27,29) |
| InChIKey | BRMXTZUHEPPHND-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |