C22H19ClF3N3O4S — CID 168786238
2-chloro-N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-5-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 168786238) has the molecular formula C22H19ClF3N3O4S and a molecular weight of 513.93 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-5-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-5-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 168786238 |
| Molecular Formula | C22H19ClF3N3O4S |
| Molecular Weight | 513.93 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 2-chloro-N-[3-[(2,6-dimethylphenyl)sulfamoyl]-4-methoxyphenyl]-5-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Cl)ncc2C(F)(F)F)cc1S(=O)(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C22H19ClF3N3O4S/c1-12-5-4-6-13(2)20(12)29-34(31,32)18-9-14(7-8-17(18)33-3)28-21(30)15-10-19(23)27-11-16(15)22(24,25)26/h4-11,29H,1-3H3,(H,28,30) |
| InChIKey | RBCVZPBWVDHQRC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|