C22H23N3O2S — CID 156860036
N-[4-(2-hydroxyethyl)-3-(4-methylanilino)sulfanylphenyl]-4-methylpyridine-3-carboxamide (PubChem CID 156860036) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)-3-(4-methylanilino)sulfanylphenyl]-4-methylpyridine-3-carboxamide.
| Compound Name | N-[4-(2-hydroxyethyl)-3-(4-methylanilino)sulfanylphenyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156860036 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[4-(2-hydroxyethyl)-3-(4-methylanilino)sulfanylphenyl]-4-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(NSc2cc(NC(=O)c3cnccc3C)ccc2CCO)cc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-15-3-6-18(7-4-15)25-28-21-13-19(8-5-17(21)10-12-26)24-22(27)20-14-23-11-9-16(20)2/h3-9,11,13-14,25-26H,10,12H2,1-2H3,(H,24,27) |
| InChIKey | DDASOZYKIGVFGO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|