C41H46Cl2FN3O4 — CID 156860680
4-[[(3S,4S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-1-dec-9-ynyl-4-methyl-1-azaspiro[4.5]decane-2-carbonyl]amino]benzoic acid (PubChem CID 156860680) has the molecular formula C41H46Cl2FN3O4 and a molecular weight of 734.74 g/mol. Its IUPAC name is 4-[[(3S,4S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-1-dec-9-ynyl-4-methyl-1-azaspiro[4.5]decane-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(3S,4S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-1-dec-9-ynyl-4-methyl-1-azaspiro[4.5]decane-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156860680 |
| Molecular Formula | C41H46Cl2FN3O4 |
| Molecular Weight | 734.74 g/mol |
| Exact Mass | 733.28 |
| IUPAC Name | 4-[[(3S,4S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-formamidophenyl)-1-dec-9-ynyl-4-methyl-1-azaspiro[4.5]decane-2-carbonyl]amino]benzoic acid |
| SMILES | C#CCCCCCCCCN1C(C(=O)Nc2ccc(C(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@@](C)(c2ccc(Cl)cc2NC=O)C12CCCCC2 |
| InChI | InChI=1S/C41H46Cl2FN3O4/c1-3-4-5-6-7-8-9-13-25-47-37(38(49)46-30-20-17-28(18-21-30)39(50)51)35(31-15-14-16-33(43)36(31)44)40(2,41(47)23-11-10-12-24-41)32-22-19-29(42)26-34(32)45-27-48/h1,14-22,26-27,35,37H,4-13,23-25H2,2H3,(H,45,48)(H,46,49)(H,50,51)/t35-,37?,40+/m0/s1 |
| InChIKey | UKEVBDCKAAOWTG-UKICZTCYSA-N |
| XLogP | 9.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.74 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|