C25H28Cl3FN2O — CID 166753161
(4R)-3-(3-chloro-2-fluorophenyl)-2-(chloromethyl)-4-[4-chloro-2-(methylamino)phenyl]-1-methyl-1-azaspiro[4.5]decane-4-carbaldehyde (PubChem CID 166753161) has the molecular formula C25H28Cl3FN2O and a molecular weight of 497.87 g/mol. Its IUPAC name is (4R)-3-(3-chloro-2-fluorophenyl)-2-(chloromethyl)-4-[4-chloro-2-(methylamino)phenyl]-1-methyl-1-azaspiro[4.5]decane-4-carbaldehyde.
| Compound Name | (4R)-3-(3-chloro-2-fluorophenyl)-2-(chloromethyl)-4-[4-chloro-2-(methylamino)phenyl]-1-methyl-1-azaspiro[4.5]decane-4-carbaldehyde |
|---|---|
| PubChem CID | 166753161 |
| Molecular Formula | C25H28Cl3FN2O |
| Molecular Weight | 497.87 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (4R)-3-(3-chloro-2-fluorophenyl)-2-(chloromethyl)-4-[4-chloro-2-(methylamino)phenyl]-1-methyl-1-azaspiro[4.5]decane-4-carbaldehyde |
| SMILES | CNc1cc(Cl)ccc1[C@]1(C=O)C(c2cccc(Cl)c2F)C(CCl)N(C)C12CCCCC2 |
| InChI | InChI=1S/C25H28Cl3FN2O/c1-30-20-13-16(27)9-10-18(20)25(15-32)22(17-7-6-8-19(28)23(17)29)21(14-26)31(2)24(25)11-4-3-5-12-24/h6-10,13,15,21-22,30H,3-5,11-12,14H2,1-2H3/t21?,22?,25-/m1/s1 |
| InChIKey | LGUJAJSYYWLOMC-XUNZJTMSSA-N |
| XLogP | 6.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.87 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|