C18H20N6O2 — CID 156860922
1-[8-(3-piperazin-1-ylprop-1-ynyl)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 156860922) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-[8-(3-piperazin-1-ylprop-1-ynyl)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[8-(3-piperazin-1-ylprop-1-ynyl)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 156860922 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[8-(3-piperazin-1-ylprop-1-ynyl)imidazo[1,2-a]pyridin-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cnc3c(C#CCN4CCNCC4)cccn23)C(=O)N1 |
| InChI | InChI=1S/C18H20N6O2/c25-15-5-10-24(18(26)21-15)16-13-20-17-14(4-2-9-23(16)17)3-1-8-22-11-6-19-7-12-22/h2,4,9,13,19H,5-8,10-12H2,(H,21,25,26) |
| InChIKey | QVRCWQQTOUGATI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|