C16H14N4O3 — CID 156860348
5-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]pent-4-ynal (PubChem CID 156860348) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]pent-4-ynal.
| Compound Name | 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]pent-4-ynal |
|---|---|
| PubChem CID | 156860348 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]pent-4-ynal |
| SMILES | O=CCCC#Cc1ccn2c(N3CCC(=O)NC3=O)cnc2c1 |
| InChI | InChI=1S/C16H14N4O3/c21-9-3-1-2-4-12-5-7-19-13(10-12)17-11-15(19)20-8-6-14(22)18-16(20)23/h5,7,9-11H,1,3,6,8H2,(H,18,22,23) |
| InChIKey | OTGGQMZVSOLBCE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|