C50H55Cl2FN8O4 — CID 170673469
CID 170673469 (PubChem CID 170673469) has the molecular formula C50H55Cl2FN8O4 and a molecular weight of 921.95 g/mol.
| Compound Name | CID 170673469 |
|---|---|
| PubChem CID | 170673469 |
| Molecular Formula | C50H55Cl2FN8O4 |
| Molecular Weight | 921.95 g/mol |
| Exact Mass | 920.37 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)C[C@@H](C(=O)NC1CCC(CN3CCC(C#Cc4ccn5c(N6CCC(=O)NC6=O)cnc5c4)CC3)CC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C50H55Cl2FN8O4/c1-48(2)16-18-49(19-17-48)27-36(42(35-11-20-54-44(52)43(35)53)50(49)37-10-7-33(51)26-38(37)57-46(50)64)45(63)56-34-8-5-32(6-9-34)29-59-21-12-30(13-22-59)3-4-31-14-23-60-39(25-31)55-28-41(60)61-24-15-40(62)58-47(61)65/h7,10-11,14,20,23,25-26,28,30,32,34,36,42H,5-6,8-9,12-13,15-19,21-22,24,27,29H2,1-2H3,(H,56,63)(H,57,64)(H,58,62,65)/t32?,34?,36-,42+,50-/m1/s1 |
| InChIKey | SONQVOHMYPLQMB-QVPQETIUSA-N |
| XLogP | 8.64 |
| TPSA | 141.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.95 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|