C38H50ClN5O6 — CID 156861084
[(2R,3S,5R)-3-(bicyclo[2.2.2]octane-1-carbonyloxy)-5-[2-chloro-6-(octanoylamino)purin-9-yl]-2-ethynyloxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 156861084) has the molecular formula C38H50ClN5O6 and a molecular weight of 708.30 g/mol. Its IUPAC name is [(2R,3S,5R)-3-(bicyclo[2.2.2]octane-1-carbonyloxy)-5-[2-chloro-6-(octanoylamino)purin-9-yl]-2-ethynyloxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | [(2R,3S,5R)-3-(bicyclo[2.2.2]octane-1-carbonyloxy)-5-[2-chloro-6-(octanoylamino)purin-9-yl]-2-ethynyloxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 156861084 |
| Molecular Formula | C38H50ClN5O6 |
| Molecular Weight | 708.30 g/mol |
| Exact Mass | 707.34 |
| IUPAC Name | [(2R,3S,5R)-3-(bicyclo[2.2.2]octane-1-carbonyloxy)-5-[2-chloro-6-(octanoylamino)purin-9-yl]-2-ethynyloxolan-2-yl]methyl bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | C#C[C@]1(COC(=O)C23CCC(CC2)CC3)O[C@@H](n2cnc3c(NC(=O)CCCCCCC)nc(Cl)nc32)C[C@@H]1OC(=O)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C38H50ClN5O6/c1-3-5-6-7-8-9-28(45)41-31-30-32(43-35(39)42-31)44(24-40-30)29-22-27(49-34(47)37-19-13-26(14-20-37)15-21-37)38(4-2,50-29)23-48-33(46)36-16-10-25(11-17-36)12-18-36/h2,24-27,29H,3,5-23H2,1H3,(H,41,42,43,45)/t25?,26?,27-,29+,36?,37?,38+/m0/s1 |
| InChIKey | MMEOWMNRDINGLE-ZUULNAHYSA-N |
| XLogP | 7.47 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.30 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|