C26H32ClN5O7S — CID 166026820
[(2R,3S,5R)-5-[6-(4-acetylsulfanylbutanoylamino)-2-chloropurin-9-yl]-2-ethynyl-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 166026820) has the molecular formula C26H32ClN5O7S and a molecular weight of 594.09 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[6-(4-acetylsulfanylbutanoylamino)-2-chloropurin-9-yl]-2-ethynyl-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,5R)-5-[6-(4-acetylsulfanylbutanoylamino)-2-chloropurin-9-yl]-2-ethynyl-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 166026820 |
| Molecular Formula | C26H32ClN5O7S |
| Molecular Weight | 594.09 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | [(2R,3S,5R)-5-[6-(4-acetylsulfanylbutanoylamino)-2-chloropurin-9-yl]-2-ethynyl-3-(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | C#C[C@]1(COC(=O)C(C)C)O[C@@H](n2cnc3c(NC(=O)CCCSC(C)=O)nc(Cl)nc32)C[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C26H32ClN5O7S/c1-7-26(12-37-23(35)14(2)3)17(38-24(36)15(4)5)11-19(39-26)32-13-28-20-21(30-25(27)31-22(20)32)29-18(34)9-8-10-40-16(6)33/h1,13-15,17,19H,8-12H2,2-6H3,(H,29,30,31,34)/t17-,19+,26+/m0/s1 |
| InChIKey | NUOTUNJXEWEEMR-BNJIMDBKSA-N |
| XLogP | 3.54 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.09 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|