C55H108N2O9 — CID 156861472
methyl 6-[3-[2-[2-[3-[[6-(2-butyldecoxy)-6-oxohexyl]-[6-(2-butyloctoxy)-6-oxohexyl]amino]propoxy]ethoxy]ethoxy]propylamino]hexanoate (PubChem CID 156861472) has the molecular formula C55H108N2O9 and a molecular weight of 941.47 g/mol. Its IUPAC name is methyl 6-[3-[2-[2-[3-[[6-(2-butyldecoxy)-6-oxohexyl]-[6-(2-butyloctoxy)-6-oxohexyl]amino]propoxy]ethoxy]ethoxy]propylamino]hexanoate.
| Compound Name | methyl 6-[3-[2-[2-[3-[[6-(2-butyldecoxy)-6-oxohexyl]-[6-(2-butyloctoxy)-6-oxohexyl]amino]propoxy]ethoxy]ethoxy]propylamino]hexanoate |
|---|---|
| PubChem CID | 156861472 |
| Molecular Formula | C55H108N2O9 |
| Molecular Weight | 941.47 g/mol |
| Exact Mass | 940.81 |
| IUPAC Name | methyl 6-[3-[2-[2-[3-[[6-(2-butyldecoxy)-6-oxohexyl]-[6-(2-butyloctoxy)-6-oxohexyl]amino]propoxy]ethoxy]ethoxy]propylamino]hexanoate |
| SMILES | CCCCCCCCC(CCCC)COC(=O)CCCCCN(CCCCCC(=O)OCC(CCCC)CCCCCC)CCCOCCOCCOCCCNCCCCCC(=O)OC |
| InChI | InChI=1S/C55H108N2O9/c1-6-10-14-16-17-22-34-52(32-13-9-4)50-66-55(60)37-25-20-28-41-57(40-27-19-24-36-54(59)65-49-51(31-12-8-3)33-21-15-11-7-2)42-30-44-63-46-48-64-47-45-62-43-29-39-56-38-26-18-23-35-53(58)61-5/h51-52,56H,6-50H2,1-5H3 |
| InChIKey | FLKHPTADPOULFJ-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.47 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|