C9H7ClFNO — CID 156862120
4-chloro-3-fluoro-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carbaldehyde (PubChem CID 156862120) has the molecular formula C9H7ClFNO and a molecular weight of 199.61 g/mol. Its IUPAC name is 4-chloro-3-fluoro-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carbaldehyde.
| Compound Name | 4-chloro-3-fluoro-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 156862120 |
| Molecular Formula | C9H7ClFNO |
| Molecular Weight | 199.61 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 4-chloro-3-fluoro-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carbaldehyde |
| SMILES | O=CC1Cc2ncc(F)c(Cl)c2C1 |
| InChI | InChI=1S/C9H7ClFNO/c10-9-6-1-5(4-13)2-8(6)12-3-7(9)11/h3-5H,1-2H2 |
| InChIKey | IXFCKSVCTKPLRD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|