About 2,7-bis(1,1-dimethoxyethyl)naphthalene
2,7-bis(1,1-dimethoxyethyl)naphthalene (PubChem CID 15686313) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,7-bis(1,1-dimethoxyethyl)naphthalene.
Molecular Properties
| Compound Name | 2,7-bis(1,1-dimethoxyethyl)naphthalene |
| PubChem CID | 15686313 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2,7-bis(1,1-dimethoxyethyl)naphthalene |
| SMILES | COC(C)(OC)c1ccc2ccc(C(C)(OC)OC)cc2c1 |
| InChI | InChI=1S/C18H24O4/c1-17(19-3,20-4)15-9-7-13-8-10-16(12-14(13)11-15)18(2,21-5)22-6/h7-12H,1-6H3 |
| InChIKey | JKYOZPZJCHBONV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,7-bis(1,1-dimethoxyethyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis(1,1-dimethoxyethyl)naphthalene?
The IUPAC name of 2,7-bis(1,1-dimethoxyethyl)naphthalene (CID 15686313) is 2,7-bis(1,1-dimethoxyethyl)naphthalene.
What is the SMILES notation for 2,7-bis(1,1-dimethoxyethyl)naphthalene?
The canonical SMILES for 2,7-bis(1,1-dimethoxyethyl)naphthalene is COC(C)(OC)c1ccc2ccc(C(C)(OC)OC)cc2c1.
What is the InChIKey of 2,7-bis(1,1-dimethoxyethyl)naphthalene?
The InChIKey is JKYOZPZJCHBONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O4/c1-17(19-3,20-4)15-9-7-13-8-10-16(12-14(13)11-15)18(2,21-5)22-6/h7-12H,1-6H3.
What are the key properties of 2,7-bis(1,1-dimethoxyethyl)naphthalene?
2,7-bis(1,1-dimethoxyethyl)naphthalene has a molecular weight of 304.39 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis(1,1-dimethoxyethyl)naphthalene is sourced from PubChem (CID 15686313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).