C18H24O4 — CID 15686313
2,7-bis(1,1-dimethoxyethyl)naphthalene (PubChem CID 15686313) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,7-bis(1,1-dimethoxyethyl)naphthalene.
| Compound Name | 2,7-bis(1,1-dimethoxyethyl)naphthalene |
|---|---|
| PubChem CID | 15686313 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2,7-bis(1,1-dimethoxyethyl)naphthalene |
| SMILES | COC(C)(OC)c1ccc2ccc(C(C)(OC)OC)cc2c1 |
| InChI | InChI=1S/C18H24O4/c1-17(19-3,20-4)15-9-7-13-8-10-16(12-14(13)11-15)18(2,21-5)22-6/h7-12H,1-6H3 |
| InChIKey | JKYOZPZJCHBONV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|